C22H33N — CID 90738048
3-ethyl-11-methyl-2-[(1Z)-3-methylpenta-1,3-dienyl]-4,5,6,7,8,10,11,12-octahydro-1-benzazecine (PubChem CID 90738048) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is 3-ethyl-11-methyl-2-[(1Z)-3-methylpenta-1,3-dienyl]-4,5,6,7,8,10,11,12-octahydro-1-benzazecine.
| Compound Name | 3-ethyl-11-methyl-2-[(1Z)-3-methylpenta-1,3-dienyl]-4,5,6,7,8,10,11,12-octahydro-1-benzazecine |
|---|---|
| PubChem CID | 90738048 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 3-ethyl-11-methyl-2-[(1Z)-3-methylpenta-1,3-dienyl]-4,5,6,7,8,10,11,12-octahydro-1-benzazecine |
| SMILES | CC=C(C)/C=C\C1=C(CC)CCCCCC2=CCC(C)C/C2=N\1 |
| InChI | InChI=1S/C22H33N/c1-5-17(3)13-15-21-19(6-2)10-8-7-9-11-20-14-12-18(4)16-22(20)23-21/h5,13-15,18H,6-12,16H2,1-4H3/b15-13+,17-5?,21-19?,23-22+ |
| InChIKey | WENUAMBSKBLGJD-REZOTPNDSA-N |
| XLogP | 6.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|