C25H36FN — CID 143722128
1-(1-ethylcyclohexyl)-N-[(3Z,6E,8Z,10Z)-5-ethylidene-2-fluoro-7-methyldodeca-1,3,6,8,10-pentaen-6-yl]ethanimine (PubChem CID 143722128) has the molecular formula C25H36FN and a molecular weight of 369.57 g/mol. Its IUPAC name is 1-(1-ethylcyclohexyl)-N-[(3Z,6E,8Z,10Z)-5-ethylidene-2-fluoro-7-methyldodeca-1,3,6,8,10-pentaen-6-yl]ethanimine.
| Compound Name | 1-(1-ethylcyclohexyl)-N-[(3Z,6E,8Z,10Z)-5-ethylidene-2-fluoro-7-methyldodeca-1,3,6,8,10-pentaen-6-yl]ethanimine |
|---|---|
| PubChem CID | 143722128 |
| Molecular Formula | C25H36FN |
| Molecular Weight | 369.57 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | 1-(1-ethylcyclohexyl)-N-[(3Z,6E,8Z,10Z)-5-ethylidene-2-fluoro-7-methyldodeca-1,3,6,8,10-pentaen-6-yl]ethanimine |
| SMILES | C=C(F)/C=C\C(=CC)C(/N=C(\C)C1(CC)CCCCC1)=C(C)\C=C/C=C\C |
| InChI | InChI=1S/C25H36FN/c1-7-10-12-15-20(4)24(23(8-2)17-16-21(5)26)27-22(6)25(9-3)18-13-11-14-19-25/h7-8,10,12,15-17H,5,9,11,13-14,18-19H2,1-4,6H3/b10-7-,15-12-,17-16-,23-8?,24-20+,27-22+ |
| InChIKey | FKGKIZIYLPOVRK-DHLBIJFNSA-N |
| XLogP | 8.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.57 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|