C14H23N3 — CID 91598868
2-ethanimidoyl-3-N-(3-methylbutan-2-yl)cyclohept-4-ene-1,3-diimine (PubChem CID 91598868) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-ethanimidoyl-3-N-(3-methylbutan-2-yl)cyclohept-4-ene-1,3-diimine.
| Compound Name | 2-ethanimidoyl-3-N-(3-methylbutan-2-yl)cyclohept-4-ene-1,3-diimine |
|---|---|
| PubChem CID | 91598868 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-ethanimidoyl-3-N-(3-methylbutan-2-yl)cyclohept-4-ene-1,3-diimine |
| SMILES | [H]/N=C(\C)C1/C(=N/C(C)C(C)C)C=CCC/C1=N\[H] |
| InChI | InChI=1S/C14H23N3/c1-9(2)11(4)17-13-8-6-5-7-12(16)14(13)10(3)15/h6,8-9,11,14-16H,5,7H2,1-4H3/b15-10+,16-12+,17-13+ |
| InChIKey | LRCWQYDVCLUOIP-ALPANZDKSA-N |
| XLogP | 3.50 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|