C9H16N2 — CID 123719177
2-[(4-methylcyclohex-2-en-1-ylidene)amino]ethanamine (PubChem CID 123719177) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-[(4-methylcyclohex-2-en-1-ylidene)amino]ethanamine.
| Compound Name | 2-[(4-methylcyclohex-2-en-1-ylidene)amino]ethanamine |
|---|---|
| PubChem CID | 123719177 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-[(4-methylcyclohex-2-en-1-ylidene)amino]ethanamine |
| SMILES | CC1C=C/C(=N/CCN)CC1 |
| InChI | InChI=1S/C9H16N2/c1-8-2-4-9(5-3-8)11-7-6-10/h2,4,8H,3,5-7,10H2,1H3/b11-9- |
| InChIKey | LQWWBUXGAZCCDO-LUAWRHEFSA-N |
| XLogP | 1.37 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|