C10H18N2 — CID 123339384
(4-propyliminocyclohex-2-en-1-yl)methanamine (PubChem CID 123339384) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (4-propyliminocyclohex-2-en-1-yl)methanamine.
| Compound Name | (4-propyliminocyclohex-2-en-1-yl)methanamine |
|---|---|
| PubChem CID | 123339384 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (4-propyliminocyclohex-2-en-1-yl)methanamine |
| SMILES | CCC/N=C1/C=CC(CN)CC1 |
| InChI | InChI=1S/C10H18N2/c1-2-7-12-10-5-3-9(8-11)4-6-10/h3,5,9H,2,4,6-8,11H2,1H3/b12-10- |
| InChIKey | ZFLRGJFQMCOWMF-BENRWUELSA-N |
| XLogP | 1.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|