C16H30N2 — CID 123139515
(4Z,7Z)-6-ethylimino-N,2-dimethyl-7-propan-2-ylnona-4,7-dien-1-amine (PubChem CID 123139515) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is (4Z,7Z)-6-ethylimino-N,2-dimethyl-7-propan-2-ylnona-4,7-dien-1-amine.
| Compound Name | (4Z,7Z)-6-ethylimino-N,2-dimethyl-7-propan-2-ylnona-4,7-dien-1-amine |
|---|---|
| PubChem CID | 123139515 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | (4Z,7Z)-6-ethylimino-N,2-dimethyl-7-propan-2-ylnona-4,7-dien-1-amine |
| SMILES | C/C=C(C(\C=C/CC(C)CNC)=N\CC)/C(C)C |
| InChI | InChI=1S/C16H30N2/c1-7-15(13(3)4)16(18-8-2)11-9-10-14(5)12-17-6/h7,9,11,13-14,17H,8,10,12H2,1-6H3/b11-9-,15-7-,18-16+ |
| InChIKey | QWJCMTBOYOGFKZ-RPMCXHIISA-N |
| XLogP | 3.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|