C14H26N2 — CID 90691312
3-but-2-enyl-7-imino-N,6-dimethyloct-3-en-1-amine (PubChem CID 90691312) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 3-but-2-enyl-7-imino-N,6-dimethyloct-3-en-1-amine.
| Compound Name | 3-but-2-enyl-7-imino-N,6-dimethyloct-3-en-1-amine |
|---|---|
| PubChem CID | 90691312 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 3-but-2-enyl-7-imino-N,6-dimethyloct-3-en-1-amine |
| SMILES | [H]/N=C(\C)C(C)CC=C(CC=CC)CCNC |
| InChI | InChI=1S/C14H26N2/c1-5-6-7-14(10-11-16-4)9-8-12(2)13(3)15/h5-6,9,12,15-16H,7-8,10-11H2,1-4H3/b6-5?,14-9?,15-13+ |
| InChIKey | MAIMCYFOOQYIBQ-FVBDTWFPSA-N |
| XLogP | 3.55 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|