C19H33N3 — CID 123745497
5-ethyl-8-imino-N-methyl-2-(3-methylidenehexa-1,4-dienyl)non-3-ene-1,9-diamine (PubChem CID 123745497) has the molecular formula C19H33N3 and a molecular weight of 303.49 g/mol. Its IUPAC name is 5-ethyl-8-imino-N-methyl-2-(3-methylidenehexa-1,4-dienyl)non-3-ene-1,9-diamine.
| Compound Name | 5-ethyl-8-imino-N-methyl-2-(3-methylidenehexa-1,4-dienyl)non-3-ene-1,9-diamine |
|---|---|
| PubChem CID | 123745497 |
| Molecular Formula | C19H33N3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | 5-ethyl-8-imino-N-methyl-2-(3-methylidenehexa-1,4-dienyl)non-3-ene-1,9-diamine |
| SMILES | [H]/N=C(\CN)CCC(C=CC(C=CC(=C)C=CC)CNC)CC |
| InChI | InChI=1S/C19H33N3/c1-5-7-16(3)8-9-18(15-22-4)11-10-17(6-2)12-13-19(21)14-20/h5,7-11,17-18,21-22H,3,6,12-15,20H2,1-2,4H3/b7-5?,9-8?,11-10?,21-19- |
| InChIKey | AKNTYLCYKVWMQT-IBEHMTFMSA-N |
| XLogP | 3.85 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|