C17H30N2 — CID 123137693
5-(6-imino-2,7-dimethylcyclodeca-1,9-dien-1-yl)pentan-1-amine (PubChem CID 123137693) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 5-(6-imino-2,7-dimethylcyclodeca-1,9-dien-1-yl)pentan-1-amine.
| Compound Name | 5-(6-imino-2,7-dimethylcyclodeca-1,9-dien-1-yl)pentan-1-amine |
|---|---|
| PubChem CID | 123137693 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 5-(6-imino-2,7-dimethylcyclodeca-1,9-dien-1-yl)pentan-1-amine |
| SMILES | [H]/N=C1\CCCC(C)=C(CCCCCN)C=CCC1C |
| InChI | InChI=1S/C17H30N2/c1-14-8-7-12-17(19)15(2)9-6-11-16(14)10-4-3-5-13-18/h6,11,15,19H,3-5,7-10,12-13,18H2,1-2H3/b11-6?,16-14?,19-17+ |
| InChIKey | YASXNLOVMVTSQO-RNUACPQZSA-N |
| XLogP | 4.61 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|