C24H39N — CID 123875553
4-but-1-enyl-2-ethyl-5,6,10-trimethyl-7-pent-2-en-2-ylcyclodeca-4,7-dien-1-imine (PubChem CID 123875553) has the molecular formula C24H39N and a molecular weight of 341.58 g/mol. Its IUPAC name is 4-but-1-enyl-2-ethyl-5,6,10-trimethyl-7-pent-2-en-2-ylcyclodeca-4,7-dien-1-imine.
| Compound Name | 4-but-1-enyl-2-ethyl-5,6,10-trimethyl-7-pent-2-en-2-ylcyclodeca-4,7-dien-1-imine |
|---|---|
| PubChem CID | 123875553 |
| Molecular Formula | C24H39N |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.31 |
| IUPAC Name | 4-but-1-enyl-2-ethyl-5,6,10-trimethyl-7-pent-2-en-2-ylcyclodeca-4,7-dien-1-imine |
| SMILES | [H]/N=C1/C(C)CC=C(C(C)=CCC)C(C)C(C)=C(C=CCC)CC1CC |
| InChI | InChI=1S/C24H39N/c1-8-11-13-22-16-21(10-3)24(25)18(5)14-15-23(17(4)12-9-2)20(7)19(22)6/h11-13,15,18,20-21,25H,8-10,14,16H2,1-7H3/b13-11?,17-12?,22-19?,23-15?,25-24- |
| InChIKey | BJGXTQIBSAKYQW-KUKBAGLTSA-N |
| XLogP | 7.66 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|