C34H41N — CID 88530058
(2Z)-1-[4-[4-[4-[(E)-hept-2-en-3-yl]cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-2,3-dihydronaphthalen-1-yl]penta-2,4-dien-1-imine (PubChem CID 88530058) has the molecular formula C34H41N and a molecular weight of 463.71 g/mol. Its IUPAC name is (2Z)-1-[4-[4-[4-[(E)-hept-2-en-3-yl]cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-2,3-dihydronaphthalen-1-yl]penta-2,4-dien-1-imine.
| Compound Name | (2Z)-1-[4-[4-[4-[(E)-hept-2-en-3-yl]cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-2,3-dihydronaphthalen-1-yl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 88530058 |
| Molecular Formula | C34H41N |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | (2Z)-1-[4-[4-[4-[(E)-hept-2-en-3-yl]cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-2,3-dihydronaphthalen-1-yl]penta-2,4-dien-1-imine |
| SMILES | [H]/N=C(\C=C/C=C)C1=c2ccccc2=C(C2CC=C(C3=CC=C(/C(=C/C)CCCC)CC3)CC2)CC1 |
| InChI | InChI=1S/C34H41N/c1-4-7-11-25(6-3)26-15-17-27(18-16-26)28-19-21-29(22-20-28)30-23-24-33(34(35)14-8-5-2)32-13-10-9-12-31(30)32/h5-6,8-10,12-15,17,19,29,35H,2,4,7,11,16,18,20-24H2,1,3H3/b14-8-,25-6+,35-34+ |
| InChIKey | SJUVNKMVTSTHQA-XNHOZZMTSA-N |
| XLogP | 8.05 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|