C21H37N — CID 91314281
N-ethyl-3-[(4-hex-4-enylcyclohepta-3,5-dien-1-yl)methyl]pentan-1-amine (PubChem CID 91314281) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is N-ethyl-3-[(4-hex-4-enylcyclohepta-3,5-dien-1-yl)methyl]pentan-1-amine.
| Compound Name | N-ethyl-3-[(4-hex-4-enylcyclohepta-3,5-dien-1-yl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 91314281 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | N-ethyl-3-[(4-hex-4-enylcyclohepta-3,5-dien-1-yl)methyl]pentan-1-amine |
| SMILES | CC=CCCCC1=CCC(CC(CC)CCNCC)CC=C1 |
| InChI | InChI=1S/C21H37N/c1-4-7-8-9-11-20-12-10-13-21(15-14-20)18-19(5-2)16-17-22-6-3/h4,7,10,12,14,19,21-22H,5-6,8-9,11,13,15-18H2,1-3H3 |
| InChIKey | MGFIDDSPCLLCIO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|