C13H24N2 — CID 123847360
1-(4-methyldeca-5,8-dien-2-ylideneamino)ethanamine (PubChem CID 123847360) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-(4-methyldeca-5,8-dien-2-ylideneamino)ethanamine.
| Compound Name | 1-(4-methyldeca-5,8-dien-2-ylideneamino)ethanamine |
|---|---|
| PubChem CID | 123847360 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-(4-methyldeca-5,8-dien-2-ylideneamino)ethanamine |
| SMILES | CC=CCC=CC(C)CC(C)=NC(C)N |
| InChI | InChI=1S/C13H24N2/c1-5-6-7-8-9-11(2)10-12(3)15-13(4)14/h5-6,8-9,11,13H,7,10,14H2,1-4H3 |
| InChIKey | KKOBZBVVWXJDFF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|