C14H24N2 — CID 90748347
6,6-dimethyl-2-N-(3-methylbutyl)cyclohept-3-ene-1,2-diimine (PubChem CID 90748347) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 6,6-dimethyl-2-N-(3-methylbutyl)cyclohept-3-ene-1,2-diimine.
| Compound Name | 6,6-dimethyl-2-N-(3-methylbutyl)cyclohept-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 90748347 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 6,6-dimethyl-2-N-(3-methylbutyl)cyclohept-3-ene-1,2-diimine |
| SMILES | [H]/N=C1\CC(C)(C)CC=C\C1=N/CCC(C)C |
| InChI | InChI=1S/C14H24N2/c1-11(2)7-9-16-13-6-5-8-14(3,4)10-12(13)15/h5-6,11,15H,7-10H2,1-4H3/b15-12+,16-13+ |
| InChIKey | SSHVCLUDARRBLK-WSGPNKEYSA-N |
| XLogP | 3.87 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|