C14H22N2 — CID 90959897
3,3,11,11-tetramethyl-2,6-diazabicyclo[5.5.0]dodeca-1,6,8-triene (PubChem CID 90959897) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 3,3,11,11-tetramethyl-2,6-diazabicyclo[5.5.0]dodeca-1,6,8-triene.
| Compound Name | 3,3,11,11-tetramethyl-2,6-diazabicyclo[5.5.0]dodeca-1,6,8-triene |
|---|---|
| PubChem CID | 90959897 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 3,3,11,11-tetramethyl-2,6-diazabicyclo[5.5.0]dodeca-1,6,8-triene |
| SMILES | CC1(C)CC=CC2=NCCC(C)(C)N=C2C1 |
| InChI | InChI=1S/C14H22N2/c1-13(2)7-5-6-11-12(10-13)16-14(3,4)8-9-15-11/h5-6H,7-10H2,1-4H3 |
| InChIKey | QYFDLCPAFVYFAL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |