C13H23N — CID 145217686
6-[(4R)-2,4-dimethylhexan-2-yl]-2,3-dihydropyridine (PubChem CID 145217686) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 6-[(4R)-2,4-dimethylhexan-2-yl]-2,3-dihydropyridine.
| Compound Name | 6-[(4R)-2,4-dimethylhexan-2-yl]-2,3-dihydropyridine |
|---|---|
| PubChem CID | 145217686 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 6-[(4R)-2,4-dimethylhexan-2-yl]-2,3-dihydropyridine |
| SMILES | CC[C@@H](C)CC(C)(C)C1=NCCC=C1 |
| InChI | InChI=1S/C13H23N/c1-5-11(2)10-13(3,4)12-8-6-7-9-14-12/h6,8,11H,5,7,9-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | GEQBETJYLYLPQH-LLVKDONJSA-N |
| XLogP | 3.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |