C14H26N2 — CID 123936136
(Z)-5-N-(3,3-dimethylhexyl)hex-3-ene-2,5-diimine (PubChem CID 123936136) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (Z)-5-N-(3,3-dimethylhexyl)hex-3-ene-2,5-diimine.
| Compound Name | (Z)-5-N-(3,3-dimethylhexyl)hex-3-ene-2,5-diimine |
|---|---|
| PubChem CID | 123936136 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (Z)-5-N-(3,3-dimethylhexyl)hex-3-ene-2,5-diimine |
| SMILES | [H]/N=C(C)/C=C\C(C)=N\CCC(C)(C)CCC |
| InChI | InChI=1S/C14H26N2/c1-6-9-14(4,5)10-11-16-13(3)8-7-12(2)15/h7-8,15H,6,9-11H2,1-5H3/b8-7-,15-12+,16-13+ |
| InChIKey | MRPOTZKQXKALBM-WKNAMRQGSA-N |
| XLogP | 4.26 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|