C11H19N — CID 123598949
7-ethyl-5,6-dimethylcyclohept-2-en-1-imine (PubChem CID 123598949) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 7-ethyl-5,6-dimethylcyclohept-2-en-1-imine.
| Compound Name | 7-ethyl-5,6-dimethylcyclohept-2-en-1-imine |
|---|---|
| PubChem CID | 123598949 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 7-ethyl-5,6-dimethylcyclohept-2-en-1-imine |
| SMILES | [H]/N=C1\C=CCC(C)C(C)C1CC |
| InChI | InChI=1S/C11H19N/c1-4-10-9(3)8(2)6-5-7-11(10)12/h5,7-10,12H,4,6H2,1-3H3/b12-11+ |
| InChIKey | MFSQAEMJOJSECP-VAWYXSNFSA-N |
| XLogP | 3.26 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|