C18H36N2 — CID 123826399
6-imino-7,9-dimethyl-5-(4-methylpentan-2-ylidene)decan-1-amine (PubChem CID 123826399) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 6-imino-7,9-dimethyl-5-(4-methylpentan-2-ylidene)decan-1-amine.
| Compound Name | 6-imino-7,9-dimethyl-5-(4-methylpentan-2-ylidene)decan-1-amine |
|---|---|
| PubChem CID | 123826399 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 6-imino-7,9-dimethyl-5-(4-methylpentan-2-ylidene)decan-1-amine |
| SMILES | [H]/N=C(/C(CCCCN)=C(C)CC(C)C)C(C)CC(C)C |
| InChI | InChI=1S/C18H36N2/c1-13(2)11-15(5)17(9-7-8-10-19)18(20)16(6)12-14(3)4/h13-14,16,20H,7-12,19H2,1-6H3/b17-15?,20-18+ |
| InChIKey | GXSIXOYMONWGOC-HLEAWDJKSA-N |
| XLogP | 5.18 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|