C20H35N3O6 — CID 23393704
5-[[7-amino-1-[(5-methyl-2-oxohexan-3-yl)amino]-1,2-dioxoheptan-3-yl]amino]-4-methyl-5-oxopentanoic acid (PubChem CID 23393704) has the molecular formula C20H35N3O6 and a molecular weight of 413.52 g/mol. Its IUPAC name is 5-[[7-amino-1-[(5-methyl-2-oxohexan-3-yl)amino]-1,2-dioxoheptan-3-yl]amino]-4-methyl-5-oxopentanoic acid.
| Compound Name | 5-[[7-amino-1-[(5-methyl-2-oxohexan-3-yl)amino]-1,2-dioxoheptan-3-yl]amino]-4-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 23393704 |
| Molecular Formula | C20H35N3O6 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 5-[[7-amino-1-[(5-methyl-2-oxohexan-3-yl)amino]-1,2-dioxoheptan-3-yl]amino]-4-methyl-5-oxopentanoic acid |
| SMILES | CC(=O)C(CC(C)C)NC(=O)C(=O)C(CCCCN)NC(=O)C(C)CCC(=O)O |
| InChI | InChI=1S/C20H35N3O6/c1-12(2)11-16(14(4)24)23-20(29)18(27)15(7-5-6-10-21)22-19(28)13(3)8-9-17(25)26/h12-13,15-16H,5-11,21H2,1-4H3,(H,22,28)(H,23,29)(H,25,26) |
| InChIKey | WJYNABAZMDQLHB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|