C20H40N2 — CID 123996683
8-imino-9,11-dimethyl-7-(4-methylpentan-2-ylidene)dodecan-1-amine (PubChem CID 123996683) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is 8-imino-9,11-dimethyl-7-(4-methylpentan-2-ylidene)dodecan-1-amine.
| Compound Name | 8-imino-9,11-dimethyl-7-(4-methylpentan-2-ylidene)dodecan-1-amine |
|---|---|
| PubChem CID | 123996683 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | 8-imino-9,11-dimethyl-7-(4-methylpentan-2-ylidene)dodecan-1-amine |
| SMILES | [H]/N=C(/C(CCCCCCN)=C(C)CC(C)C)C(C)CC(C)C |
| InChI | InChI=1S/C20H40N2/c1-15(2)13-17(5)19(11-9-7-8-10-12-21)20(22)18(6)14-16(3)4/h15-16,18,22H,7-14,21H2,1-6H3/b19-17?,22-20+ |
| InChIKey | KRAWLKPFNYWDPW-WYYOTIKDSA-N |
| XLogP | 5.96 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|