C23H42N2 — CID 123664372
5-imino-5-(3,3,5-trimethylcyclohexyl)-4-(3,3,5-trimethylcyclohexylidene)pentan-1-amine (PubChem CID 123664372) has the molecular formula C23H42N2 and a molecular weight of 346.60 g/mol. Its IUPAC name is 5-imino-5-(3,3,5-trimethylcyclohexyl)-4-(3,3,5-trimethylcyclohexylidene)pentan-1-amine.
| Compound Name | 5-imino-5-(3,3,5-trimethylcyclohexyl)-4-(3,3,5-trimethylcyclohexylidene)pentan-1-amine |
|---|---|
| PubChem CID | 123664372 |
| Molecular Formula | C23H42N2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.33 |
| IUPAC Name | 5-imino-5-(3,3,5-trimethylcyclohexyl)-4-(3,3,5-trimethylcyclohexylidene)pentan-1-amine |
| SMILES | [H]/N=C(/C(CCCN)=C1CC(C)CC(C)(C)C1)C1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C23H42N2/c1-16-10-18(14-22(3,4)12-16)20(8-7-9-24)21(25)19-11-17(2)13-23(5,6)15-19/h16-17,19,25H,7-15,24H2,1-6H3/b20-18?,25-21+ |
| InChIKey | CUTMIWASGZALFZ-INOPHNIMSA-N |
| XLogP | 6.35 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|