C31H57N3 — CID 145436103
(E)-4-ethanimidoyl-6-[(2-imino-5-methylidenecyclohexyl)methyl]-8,8,9,9,11,11,12,12-octamethyltridec-6-en-2-amine (PubChem CID 145436103) has the molecular formula C31H57N3 and a molecular weight of 471.82 g/mol. Its IUPAC name is (E)-4-ethanimidoyl-6-[(2-imino-5-methylidenecyclohexyl)methyl]-8,8,9,9,11,11,12,12-octamethyltridec-6-en-2-amine.
| Compound Name | (E)-4-ethanimidoyl-6-[(2-imino-5-methylidenecyclohexyl)methyl]-8,8,9,9,11,11,12,12-octamethyltridec-6-en-2-amine |
|---|---|
| PubChem CID | 145436103 |
| Molecular Formula | C31H57N3 |
| Molecular Weight | 471.82 g/mol |
| Exact Mass | 471.46 |
| IUPAC Name | (E)-4-ethanimidoyl-6-[(2-imino-5-methylidenecyclohexyl)methyl]-8,8,9,9,11,11,12,12-octamethyltridec-6-en-2-amine |
| SMILES | [H]/N=C(\C)C(C/C(=C\C(C)(C)C(C)(C)CC(C)(C)C(C)(C)C)CC1CC(=C)CC/C1=N\[H])CC(C)N |
| InChI | InChI=1S/C31H57N3/c1-21-13-14-27(34)26(15-21)18-24(17-25(23(3)33)16-22(2)32)19-29(7,8)31(11,12)20-30(9,10)28(4,5)6/h19,22,25-26,33-34H,1,13-18,20,32H2,2-12H3/b24-19+,33-23+,34-27+ |
| InChIKey | OEVSUBCJNIBVCD-DRYYDXDMSA-N |
| XLogP | 8.98 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.82 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|