C22H36N2 — CID 67174652
6-(6-butyliminocyclohexen-1-yl)-2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 67174652) has the molecular formula C22H36N2 and a molecular weight of 328.54 g/mol. Its IUPAC name is 6-(6-butyliminocyclohexen-1-yl)-2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 6-(6-butyliminocyclohexen-1-yl)-2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 67174652 |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | 6-(6-butyliminocyclohexen-1-yl)-2,6-di(propan-2-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | CCCC/N=C1\CCCC=C1C1(C(C)C)C=CC=C(C(C)C)C1N |
| InChI | InChI=1S/C22H36N2/c1-6-7-15-24-20-13-9-8-12-19(20)22(17(4)5)14-10-11-18(16(2)3)21(22)23/h10-12,14,16-17,21H,6-9,13,15,23H2,1-5H3/b24-20+ |
| InChIKey | SIICIIRTMIWZAX-HIXSDJFHSA-N |
| XLogP | 5.46 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|