C28H57N — CID 90984282
7-butan-2-yl-3,8,8,9-tetraethyl-5,9-dimethyl-3-propylundec-5-en-2-amine (PubChem CID 90984282) has the molecular formula C28H57N and a molecular weight of 407.77 g/mol. Its IUPAC name is 7-butan-2-yl-3,8,8,9-tetraethyl-5,9-dimethyl-3-propylundec-5-en-2-amine.
| Compound Name | 7-butan-2-yl-3,8,8,9-tetraethyl-5,9-dimethyl-3-propylundec-5-en-2-amine |
|---|---|
| PubChem CID | 90984282 |
| Molecular Formula | C28H57N |
| Molecular Weight | 407.77 g/mol |
| Exact Mass | 407.45 |
| IUPAC Name | 7-butan-2-yl-3,8,8,9-tetraethyl-5,9-dimethyl-3-propylundec-5-en-2-amine |
| SMILES | CCCC(CC)(CC(C)=CC(C(C)CC)C(CC)(CC)C(C)(CC)CC)C(C)N |
| InChI | InChI=1S/C28H57N/c1-12-19-27(16-5,24(10)29)21-22(8)20-25(23(9)13-2)28(17-6,18-7)26(11,14-3)15-4/h20,23-25H,12-19,21,29H2,1-11H3 |
| InChIKey | FZKXDENGARBIIF-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.77 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|