C17H32N2 — CID 145299305
(Z)-7-cyclohexyl-3,3,5-trimethyl-7-methyliminohept-5-en-1-amine (PubChem CID 145299305) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is (Z)-7-cyclohexyl-3,3,5-trimethyl-7-methyliminohept-5-en-1-amine.
| Compound Name | (Z)-7-cyclohexyl-3,3,5-trimethyl-7-methyliminohept-5-en-1-amine |
|---|---|
| PubChem CID | 145299305 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | (Z)-7-cyclohexyl-3,3,5-trimethyl-7-methyliminohept-5-en-1-amine |
| SMILES | C/N=C(\C=C(\C)CC(C)(C)CCN)C1CCCCC1 |
| InChI | InChI=1S/C17H32N2/c1-14(13-17(2,3)10-11-18)12-16(19-4)15-8-6-5-7-9-15/h12,15H,5-11,13,18H2,1-4H3/b14-12-,19-16+ |
| InChIKey | BTALCUZMFLOGBW-MGYJKCISSA-N |
| XLogP | 4.35 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|