C12H20N2 — CID 144780867
4-(3-methyl-2,3-dihydropyridin-6-yl)cyclohexan-1-amine (PubChem CID 144780867) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 4-(3-methyl-2,3-dihydropyridin-6-yl)cyclohexan-1-amine.
| Compound Name | 4-(3-methyl-2,3-dihydropyridin-6-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 144780867 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4-(3-methyl-2,3-dihydropyridin-6-yl)cyclohexan-1-amine |
| SMILES | CC1C=CC(C2CCC(N)CC2)=NC1 |
| InChI | InChI=1S/C12H20N2/c1-9-2-7-12(14-8-9)10-3-5-11(13)6-4-10/h2,7,9-11H,3-6,8,13H2,1H3 |
| InChIKey | ZOXJXBLGWVADBM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |