C23H42N2 — CID 145299304
(Z)-7-cyclohexyl-3,3,5-trimethyl-7-methyliminohept-5-en-1-amine;(3Z)-2-methylpenta-1,3-diene (PubChem CID 145299304) has the molecular formula C23H42N2 and a molecular weight of 346.60 g/mol. Its IUPAC name is (Z)-7-cyclohexyl-3,3,5-trimethyl-7-methyliminohept-5-en-1-amine;(3Z)-2-methylpenta-1,3-diene.
| Compound Name | (Z)-7-cyclohexyl-3,3,5-trimethyl-7-methyliminohept-5-en-1-amine;(3Z)-2-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 145299304 |
| Molecular Formula | C23H42N2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.33 |
| IUPAC Name | (Z)-7-cyclohexyl-3,3,5-trimethyl-7-methyliminohept-5-en-1-amine;(3Z)-2-methylpenta-1,3-diene |
| SMILES | C/N=C(\C=C(\C)CC(C)(C)CCN)C1CCCCC1.C=C(C)/C=C\C |
| InChI | InChI=1S/C17H32N2.C6H10/c1-14(13-17(2,3)10-11-18)12-16(19-4)15-8-6-5-7-9-15;1-4-5-6(2)3/h12,15H,5-11,13,18H2,1-4H3;4-5H,2H2,1,3H3/b14-12-,19-16+;5-4- |
| InChIKey | AWEISLYCKSYXBL-BJXWFMOFSA-N |
| XLogP | 6.49 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|