C19H33N3 — CID 142230331
N-[[3,4-bis(methylimino)cyclohexa-1,5-dien-1-yl]methyl]-4-ethylcyclohexan-1-amine;ethane (PubChem CID 142230331) has the molecular formula C19H33N3 and a molecular weight of 303.49 g/mol. Its IUPAC name is N-[[3,4-bis(methylimino)cyclohexa-1,5-dien-1-yl]methyl]-4-ethylcyclohexan-1-amine;ethane.
| Compound Name | N-[[3,4-bis(methylimino)cyclohexa-1,5-dien-1-yl]methyl]-4-ethylcyclohexan-1-amine;ethane |
|---|---|
| PubChem CID | 142230331 |
| Molecular Formula | C19H33N3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | N-[[3,4-bis(methylimino)cyclohexa-1,5-dien-1-yl]methyl]-4-ethylcyclohexan-1-amine;ethane |
| SMILES | CC.CCC1CCC(NCC2=CC(=N\C)/C(=N/C)C=C2)CC1 |
| InChI | InChI=1S/C17H27N3.C2H6/c1-4-13-5-8-15(9-6-13)20-12-14-7-10-16(18-2)17(11-14)19-3;1-2/h7,10-11,13,15,20H,4-6,8-9,12H2,1-3H3;1-2H3/b18-16+,19-17+; |
| InChIKey | NCCIXPFMPNQKGO-UVZMXQQFSA-N |
| XLogP | 4.21 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|