C19H32FN3 — CID 123714233
2-ethylimino-5-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]pentan-1-amine (PubChem CID 123714233) has the molecular formula C19H32FN3 and a molecular weight of 321.48 g/mol. Its IUPAC name is 2-ethylimino-5-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]pentan-1-amine.
| Compound Name | 2-ethylimino-5-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]pentan-1-amine |
|---|---|
| PubChem CID | 123714233 |
| Molecular Formula | C19H32FN3 |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.26 |
| IUPAC Name | 2-ethylimino-5-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]pentan-1-amine |
| SMILES | CC/N=C(\CN)CCCC1=CCCNC1C1C=CC(F)C(C)C1 |
| InChI | InChI=1S/C19H32FN3/c1-3-22-17(13-21)8-4-6-15-7-5-11-23-19(15)16-9-10-18(20)14(2)12-16/h7,9-10,14,16,18-19,23H,3-6,8,11-13,21H2,1-2H3/b22-17- |
| InChIKey | MBCPDWDPRIYDNJ-XLNRJJMWSA-N |
| XLogP | 3.41 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|