C16H31FN2 — CID 144703296
N-[[4-(1-aminoethyl)cyclohex-3-en-1-yl]methyl]-3-fluoro-3-methylhexan-1-amine (PubChem CID 144703296) has the molecular formula C16H31FN2 and a molecular weight of 270.44 g/mol. Its IUPAC name is N-[[4-(1-aminoethyl)cyclohex-3-en-1-yl]methyl]-3-fluoro-3-methylhexan-1-amine.
| Compound Name | N-[[4-(1-aminoethyl)cyclohex-3-en-1-yl]methyl]-3-fluoro-3-methylhexan-1-amine |
|---|---|
| PubChem CID | 144703296 |
| Molecular Formula | C16H31FN2 |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.25 |
| IUPAC Name | N-[[4-(1-aminoethyl)cyclohex-3-en-1-yl]methyl]-3-fluoro-3-methylhexan-1-amine |
| SMILES | CCCC(C)(F)CCNCC1CC=C(C(C)N)CC1 |
| InChI | InChI=1S/C16H31FN2/c1-4-9-16(3,17)10-11-19-12-14-5-7-15(8-6-14)13(2)18/h7,13-14,19H,4-6,8-12,18H2,1-3H3 |
| InChIKey | PGGFSQXDYJXBKU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|