C20H32N2 — CID 5018062
4-[2,6-bis(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridin-4-yl]hepta-1,6-dien-4-amine (PubChem CID 5018062) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 4-[2,6-bis(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridin-4-yl]hepta-1,6-dien-4-amine.
| Compound Name | 4-[2,6-bis(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridin-4-yl]hepta-1,6-dien-4-amine |
|---|---|
| PubChem CID | 5018062 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | 4-[2,6-bis(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridin-4-yl]hepta-1,6-dien-4-amine |
| SMILES | C=CCC(N)(CC=C)C1=CC(CC(=C)C)NC(CC(=C)C)C1 |
| InChI | InChI=1S/C20H32N2/c1-7-9-20(21,10-8-2)17-13-18(11-15(3)4)22-19(14-17)12-16(5)6/h7-8,13,18-19,22H,1-3,5,9-12,14,21H2,4,6H3 |
| InChIKey | WMHNXNGDBQGNPS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|