C13H20FN — CID 139453705
6-[(5S)-4-fluoro-5-methylcyclohex-2-en-1-yl]-5-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 139453705) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is 6-[(5S)-4-fluoro-5-methylcyclohex-2-en-1-yl]-5-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 6-[(5S)-4-fluoro-5-methylcyclohex-2-en-1-yl]-5-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 139453705 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 6-[(5S)-4-fluoro-5-methylcyclohex-2-en-1-yl]-5-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | CC1=CCCNC1C1C=CC(F)[C@@H](C)C1 |
| InChI | InChI=1S/C13H20FN/c1-9-4-3-7-15-13(9)11-5-6-12(14)10(2)8-11/h4-6,10-13,15H,3,7-8H2,1-2H3/t10-,11?,12?,13?/m0/s1 |
| InChIKey | NKTSNGBTQJKOCB-DCNVRKPOSA-N |
| XLogP | 2.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|