C18H24FN3 — CID 163893228
3-(3-fluorocyclohexa-2,4-dien-1-yl)-N-piperidin-4-yl-7-azabicyclo[4.2.0]octa-2,6-dien-5-amine (PubChem CID 163893228) has the molecular formula C18H24FN3 and a molecular weight of 301.41 g/mol. Its IUPAC name is 3-(3-fluorocyclohexa-2,4-dien-1-yl)-N-piperidin-4-yl-7-azabicyclo[4.2.0]octa-2,6-dien-5-amine.
| Compound Name | 3-(3-fluorocyclohexa-2,4-dien-1-yl)-N-piperidin-4-yl-7-azabicyclo[4.2.0]octa-2,6-dien-5-amine |
|---|---|
| PubChem CID | 163893228 |
| Molecular Formula | C18H24FN3 |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 3-(3-fluorocyclohexa-2,4-dien-1-yl)-N-piperidin-4-yl-7-azabicyclo[4.2.0]octa-2,6-dien-5-amine |
| SMILES | FC1=CC(C2=CC3CN=C3C(NC3CCNCC3)C2)CC=C1 |
| InChI | InChI=1S/C18H24FN3/c19-15-3-1-2-12(9-15)13-8-14-11-21-18(14)17(10-13)22-16-4-6-20-7-5-16/h1,3,8-9,12,14,16-17,20,22H,2,4-7,10-11H2 |
| InChIKey | QDJJFECLPFSXRD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|