C16H18N2 — CID 140807047
1,2,3,4,4a,5,6,6a-octahydrobenzo[b][1,10]phenanthroline (PubChem CID 140807047) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,6a-octahydrobenzo[b][1,10]phenanthroline.
| Compound Name | 1,2,3,4,4a,5,6,6a-octahydrobenzo[b][1,10]phenanthroline |
|---|---|
| PubChem CID | 140807047 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1,2,3,4,4a,5,6,6a-octahydrobenzo[b][1,10]phenanthroline |
| SMILES | C1=c2ccccc2=NC2=C3NCCCC3CCC12 |
| InChI | InChI=1S/C16H18N2/c1-2-6-14-12(4-1)10-13-8-7-11-5-3-9-17-15(11)16(13)18-14/h1-2,4,6,10-11,13,17H,3,5,7-9H2 |
| InChIKey | BQNAPGGODHCQSZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |