C17H19N — CID 129724134
Octahydrodibenzoquinoline (PubChem CID 129724134) has the molecular formula C17H19N and a molecular weight of 237.34 g/mol. Its IUPAC name is 1,2,3,4,4a,4b,5,6-octahydrophenanthro[9,10-b]pyridine.
| Compound Name | Octahydrodibenzoquinoline |
|---|---|
| PubChem CID | 129724134 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1,2,3,4,4a,4b,5,6-octahydrophenanthro[9,10-b]pyridine |
| SMILES | C1CC2C3CCC=CC3=C4C=CC=CC4=C2NC1 |
| InChI | InChI=1S/C17H19N/c1-2-7-14-12(6-1)13-8-3-4-9-15(13)17-16(14)10-5-11-18-17/h1,3-4,6,8-9,14,16,18H,2,5,7,10-11H2 |
| InChIKey | RSHMMZVBPPYLKD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | 528 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |