C12H16F2N2 — CID 142867709
(4,6-difluorocyclohexa-1,3-dien-1-yl)-piperidin-4-ylmethanimine (PubChem CID 142867709) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is (4,6-difluorocyclohexa-1,3-dien-1-yl)-piperidin-4-ylmethanimine.
| Compound Name | (4,6-difluorocyclohexa-1,3-dien-1-yl)-piperidin-4-ylmethanimine |
|---|---|
| PubChem CID | 142867709 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (4,6-difluorocyclohexa-1,3-dien-1-yl)-piperidin-4-ylmethanimine |
| SMILES | [H]/N=C(/C1=CC=C(F)CC1F)C1CCNCC1 |
| InChI | InChI=1S/C12H16F2N2/c13-9-1-2-10(11(14)7-9)12(15)8-3-5-16-6-4-8/h1-2,8,11,15-16H,3-7H2/b15-12+ |
| InChIKey | CEEKILIIXGMJQW-NTCAYCPXSA-N |
| XLogP | 2.53 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|