C12H19F3N2 — CID 123932115
1,1,1-trifluoro-4-methyl-5-piperidin-2-ylhex-3-en-2-imine (PubChem CID 123932115) has the molecular formula C12H19F3N2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-methyl-5-piperidin-2-ylhex-3-en-2-imine.
| Compound Name | 1,1,1-trifluoro-4-methyl-5-piperidin-2-ylhex-3-en-2-imine |
|---|---|
| PubChem CID | 123932115 |
| Molecular Formula | C12H19F3N2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 1,1,1-trifluoro-4-methyl-5-piperidin-2-ylhex-3-en-2-imine |
| SMILES | [H]/N=C(/C=C(C)C(C)C1CCCCN1)C(F)(F)F |
| InChI | InChI=1S/C12H19F3N2/c1-8(7-11(16)12(13,14)15)9(2)10-5-3-4-6-17-10/h7,9-10,16-17H,3-6H2,1-2H3/b8-7?,16-11- |
| InChIKey | LAABEXYACGAXDE-XQUSMODOSA-N |
| XLogP | 3.29 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|