C12H20F2N2 — CID 176942219
3-(azetidin-3-ylidenemethyl)-2-(1,1-difluoroethyl)-5-methylpiperidine (PubChem CID 176942219) has the molecular formula C12H20F2N2 and a molecular weight of 230.30 g/mol. Its IUPAC name is 3-(azetidin-3-ylidenemethyl)-2-(1,1-difluoroethyl)-5-methylpiperidine.
| Compound Name | 3-(azetidin-3-ylidenemethyl)-2-(1,1-difluoroethyl)-5-methylpiperidine |
|---|---|
| PubChem CID | 176942219 |
| Molecular Formula | C12H20F2N2 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 3-(azetidin-3-ylidenemethyl)-2-(1,1-difluoroethyl)-5-methylpiperidine |
| SMILES | CC1CNC(C(C)(F)F)C(C=C2CNC2)C1 |
| InChI | InChI=1S/C12H20F2N2/c1-8-3-10(4-9-6-15-7-9)11(16-5-8)12(2,13)14/h4,8,10-11,15-16H,3,5-7H2,1-2H3 |
| InChIKey | MMKGGMWNLOTVEH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|