About (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine
(NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine (PubChem CID 172919945) has the molecular formula C12H18F2N2O
and a molecular weight of 244.28 g/mol. Its IUPAC name is (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine |
| PubChem CID | 172919945 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine |
| SMILES | O/N=C(\C1=CCC(F)CC1F)C1CCNCC1 |
| InChI | InChI=1S/C12H18F2N2O/c13-9-1-2-10(11(14)7-9)12(16-17)8-3-5-15-6-4-8/h2,8-9,11,15,17H,1,3-7H2/b16-12- |
| InChIKey | OYCQLTLWOGJKMH-VBKFSLOCSA-N |
| XLogP | 2.21 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine (CID 172919945) is (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine is O/N=C(\C1=CCC(F)CC1F)C1CCNCC1.
What is the InChIKey of (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine?
The InChIKey is OYCQLTLWOGJKMH-VBKFSLOCSA-N. The full InChI is InChI=1S/C12H18F2N2O/c13-9-1-2-10(11(14)7-9)12(16-17)8-3-5-15-6-4-8/h2,8-9,11,15,17H,1,3-7H2/b16-12-.
What are the key properties of (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine?
(NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine has a molecular weight of 244.28 g/mol, XLogP of 2.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[(4,6-difluorocyclohexen-1-yl)-piperidin-4-ylmethylidene]hydroxylamine is sourced from PubChem (CID 172919945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).