C24H35F2N3 — CID 91054963
6-(2-ethenyl-2,5-dihydro-1H-pyrrol-3-yl)-4-fluoro-N-[[3-(2-fluoro-3,4-dimethylpentan-2-yl)cyclopropa-1,2-dien-1-yl]methyl]-5-iminohept-3-en-1-amine (PubChem CID 91054963) has the molecular formula C24H35F2N3 and a molecular weight of 403.56 g/mol. Its IUPAC name is 6-(2-ethenyl-2,5-dihydro-1H-pyrrol-3-yl)-4-fluoro-N-[[3-(2-fluoro-3,4-dimethylpentan-2-yl)cyclopropa-1,2-dien-1-yl]methyl]-5-iminohept-3-en-1-amine.
| Compound Name | 6-(2-ethenyl-2,5-dihydro-1H-pyrrol-3-yl)-4-fluoro-N-[[3-(2-fluoro-3,4-dimethylpentan-2-yl)cyclopropa-1,2-dien-1-yl]methyl]-5-iminohept-3-en-1-amine |
|---|---|
| PubChem CID | 91054963 |
| Molecular Formula | C24H35F2N3 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | 6-(2-ethenyl-2,5-dihydro-1H-pyrrol-3-yl)-4-fluoro-N-[[3-(2-fluoro-3,4-dimethylpentan-2-yl)cyclopropa-1,2-dien-1-yl]methyl]-5-iminohept-3-en-1-amine |
| SMILES | [H]/N=C(\C(F)=CCCNCC1=C=C1C(C)(F)C(C)C(C)C)C(C)C1=CCNC1C=C |
| InChI | InChI=1S/C24H35F2N3/c1-7-22-19(10-12-29-22)16(4)23(27)21(25)9-8-11-28-14-18-13-20(18)24(6,26)17(5)15(2)3/h7,9-10,15-17,22,27-29H,1,8,11-12,14H2,2-6H3/b21-9?,27-23- |
| InChIKey | FOUFONDAAONHOM-AJCLNLPOSA-N |
| XLogP | 5.05 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|