C19H32N2 — CID 143606113
[2-[N-ethyl-C-[(4Z,6Z)-3-methylocta-4,6-dienyl]carbonimidoyl]cyclohexen-1-yl]methanamine (PubChem CID 143606113) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is [2-[N-ethyl-C-[(4Z,6Z)-3-methylocta-4,6-dienyl]carbonimidoyl]cyclohexen-1-yl]methanamine.
| Compound Name | [2-[N-ethyl-C-[(4Z,6Z)-3-methylocta-4,6-dienyl]carbonimidoyl]cyclohexen-1-yl]methanamine |
|---|---|
| PubChem CID | 143606113 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | [2-[N-ethyl-C-[(4Z,6Z)-3-methylocta-4,6-dienyl]carbonimidoyl]cyclohexen-1-yl]methanamine |
| SMILES | C/C=C\C=C/C(C)CC/C(=N\CC)C1=C(CN)CCCC1 |
| InChI | InChI=1S/C19H32N2/c1-4-6-7-10-16(3)13-14-19(21-5-2)18-12-9-8-11-17(18)15-20/h4,6-7,10,16H,5,8-9,11-15,20H2,1-3H3/b6-4-,10-7-,21-19+ |
| InChIKey | PZPMDNCWXRWZJX-CQYBRVDPSA-N |
| XLogP | 4.83 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|