C25H32N2 — CID 91188452
2-[2-[1-(3,4-dihydrobenzo[7]annulen-1-yl)prop-1-enylimino]-3-methylbut-3-enyl]cyclohexan-1-amine (PubChem CID 91188452) has the molecular formula C25H32N2 and a molecular weight of 360.55 g/mol. Its IUPAC name is 2-[2-[1-(3,4-dihydrobenzo[7]annulen-1-yl)prop-1-enylimino]-3-methylbut-3-enyl]cyclohexan-1-amine.
| Compound Name | 2-[2-[1-(3,4-dihydrobenzo[7]annulen-1-yl)prop-1-enylimino]-3-methylbut-3-enyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 91188452 |
| Molecular Formula | C25H32N2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 2-[2-[1-(3,4-dihydrobenzo[7]annulen-1-yl)prop-1-enylimino]-3-methylbut-3-enyl]cyclohexan-1-amine |
| SMILES | C=C(C)/C(CC1CCCCC1N)=N\C(=CC)C1=CCCC2=C=CC=CC=C21 |
| InChI | InChI=1S/C25H32N2/c1-4-24(22-15-10-13-19-11-6-5-7-14-21(19)22)27-25(18(2)3)17-20-12-8-9-16-23(20)26/h4-7,14-15,20,23H,2,8-10,12-13,16-17,26H2,1,3H3/b24-4?,27-25- |
| InChIKey | DYSXFWNPSNMHKR-FTABATHQSA-N |
| XLogP | 6.11 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|