C21H37N3 — CID 144928597
(2Z,4E)-1-cyclohexyl-N,4,5-trimethylhepta-2,4-dien-1-imine;(1Z,3Z)-penta-1,3-diene-1,4-diamine (PubChem CID 144928597) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is (2Z,4E)-1-cyclohexyl-N,4,5-trimethylhepta-2,4-dien-1-imine;(1Z,3Z)-penta-1,3-diene-1,4-diamine.
| Compound Name | (2Z,4E)-1-cyclohexyl-N,4,5-trimethylhepta-2,4-dien-1-imine;(1Z,3Z)-penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 144928597 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | (2Z,4E)-1-cyclohexyl-N,4,5-trimethylhepta-2,4-dien-1-imine;(1Z,3Z)-penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C\N.CC/C(C)=C(C)/C=C\C(=N\C)C1CCCCC1 |
| InChI | InChI=1S/C16H27N.C5H10N2/c1-5-13(2)14(3)11-12-16(17-4)15-9-7-6-8-10-15;1-5(7)3-2-4-6/h11-12,15H,5-10H2,1-4H3;2-4H,6-7H2,1H3/b12-11-,14-13+,17-16-;4-2-,5-3- |
| InChIKey | QQIAYEBQXHMHSY-UQYISPHJSA-N |
| XLogP | 5.26 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|