C20H38N2 — CID 143346157
ethane;3-[[(3E)-8-methyl-9-methylideneundeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine (PubChem CID 143346157) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is ethane;3-[[(3E)-8-methyl-9-methylideneundeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine.
| Compound Name | ethane;3-[[(3E)-8-methyl-9-methylideneundeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine |
|---|---|
| PubChem CID | 143346157 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | ethane;3-[[(3E)-8-methyl-9-methylideneundeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine |
| SMILES | C=CC(=C)C(C)CCC/C=C/C(C)=N/CC(=C)N.CC.CC |
| InChI | InChI=1S/C16H26N2.2C2H6/c1-6-13(2)14(3)10-8-7-9-11-16(5)18-12-15(4)17;2*1-2/h6,9,11,14H,1-2,4,7-8,10,12,17H2,3,5H3;2*1-2H3/b11-9+,18-16+;; |
| InChIKey | PXAPAKVOFDNORV-PLKMDLKESA-N |
| XLogP | 6.08 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|