C20H36N2 — CID 143343426
3-[[(3E)-3-ethyl-5,5,8-trimethylundeca-3,10-dien-2-ylidene]amino]-N-methylprop-1-en-2-amine (PubChem CID 143343426) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 3-[[(3E)-3-ethyl-5,5,8-trimethylundeca-3,10-dien-2-ylidene]amino]-N-methylprop-1-en-2-amine.
| Compound Name | 3-[[(3E)-3-ethyl-5,5,8-trimethylundeca-3,10-dien-2-ylidene]amino]-N-methylprop-1-en-2-amine |
|---|---|
| PubChem CID | 143343426 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 3-[[(3E)-3-ethyl-5,5,8-trimethylundeca-3,10-dien-2-ylidene]amino]-N-methylprop-1-en-2-amine |
| SMILES | C=CCC(C)CCC(C)(C)/C=C(CC)/C(C)=N/CC(=C)NC |
| InChI | InChI=1S/C20H36N2/c1-9-11-16(3)12-13-20(6,7)14-19(10-2)18(5)22-15-17(4)21-8/h9,14,16,21H,1,4,10-13,15H2,2-3,5-8H3/b19-14+,22-18+ |
| InChIKey | ZHXQDKLHTVUSRY-ALLHWFAESA-N |
| XLogP | 5.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|