C23H36N2 — CID 147441429
N-but-3-en-2-yl-4-(2,6-ditert-butyl-3,4-dihydropyridin-4-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 147441429) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is N-but-3-en-2-yl-4-(2,6-ditert-butyl-3,4-dihydropyridin-4-yl)cyclohexa-2,4-dien-1-amine.
| Compound Name | N-but-3-en-2-yl-4-(2,6-ditert-butyl-3,4-dihydropyridin-4-yl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 147441429 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | N-but-3-en-2-yl-4-(2,6-ditert-butyl-3,4-dihydropyridin-4-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | C=CC(C)NC1C=CC(C2C=C(C(C)(C)C)N=C(C(C)(C)C)C2)=CC1 |
| InChI | InChI=1S/C23H36N2/c1-9-16(2)24-19-12-10-17(11-13-19)18-14-20(22(3,4)5)25-21(15-18)23(6,7)8/h9-12,14,16,18-19,24H,1,13,15H2,2-8H3 |
| InChIKey | DWHLXHRDVRJERB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|