C19H37N3 — CID 143345133
3-[[(2E)-2,8-dimethylundeca-2,10-dienylidene]amino]-N-ethylprop-1-en-2-amine;methanamine (PubChem CID 143345133) has the molecular formula C19H37N3 and a molecular weight of 307.53 g/mol. Its IUPAC name is 3-[[(2E)-2,8-dimethylundeca-2,10-dienylidene]amino]-N-ethylprop-1-en-2-amine;methanamine.
| Compound Name | 3-[[(2E)-2,8-dimethylundeca-2,10-dienylidene]amino]-N-ethylprop-1-en-2-amine;methanamine |
|---|---|
| PubChem CID | 143345133 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | 3-[[(2E)-2,8-dimethylundeca-2,10-dienylidene]amino]-N-ethylprop-1-en-2-amine;methanamine |
| SMILES | C=CCC(C)CCCC/C=C(C)/C=N/CC(=C)NCC.CN |
| InChI | InChI=1S/C18H32N2.CH5N/c1-6-11-16(3)12-9-8-10-13-17(4)14-19-15-18(5)20-7-2;1-2/h6,13-14,16,20H,1,5,7-12,15H2,2-4H3;2H2,1H3/b17-13+,19-14+; |
| InChIKey | NYGAEOXXYGEXDV-BNIRRVGSSA-N |
| XLogP | 4.47 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|