C26H40N2 — CID 142402426
(E,9Z)-10-(cyclohepta-1,3,5-trien-1-ylmethylideneamino)-9-ethylidene-7-prop-1-enyltridec-10-en-1-amine (PubChem CID 142402426) has the molecular formula C26H40N2 and a molecular weight of 380.62 g/mol. Its IUPAC name is (E,9Z)-10-(cyclohepta-1,3,5-trien-1-ylmethylideneamino)-9-ethylidene-7-prop-1-enyltridec-10-en-1-amine.
| Compound Name | (E,9Z)-10-(cyclohepta-1,3,5-trien-1-ylmethylideneamino)-9-ethylidene-7-prop-1-enyltridec-10-en-1-amine |
|---|---|
| PubChem CID | 142402426 |
| Molecular Formula | C26H40N2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | (E,9Z)-10-(cyclohepta-1,3,5-trien-1-ylmethylideneamino)-9-ethylidene-7-prop-1-enyltridec-10-en-1-amine |
| SMILES | CC=CC(CCCCCCN)CC(=C/C)/C(=C\CC)/N=C/C1=CC=CC=CC1 |
| InChI | InChI=1S/C26H40N2/c1-4-15-23(17-11-9-10-14-20-27)21-25(6-3)26(16-5-2)28-22-24-18-12-7-8-13-19-24/h4,6-8,12-13,15-16,18,22-23H,5,9-11,14,17,19-21,27H2,1-3H3/b15-4?,25-6-,26-16+,28-22+ |
| InChIKey | YLLHAJNPHYAPRE-VHAGTUDRSA-N |
| XLogP | 7.23 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|