C22H35N — CID 123857363
3,6,6-trimethyl-3-nonan-5-yl-4H-cyclohepta[b]pyridine (PubChem CID 123857363) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is 3,6,6-trimethyl-3-nonan-5-yl-4H-cyclohepta[b]pyridine.
| Compound Name | 3,6,6-trimethyl-3-nonan-5-yl-4H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 123857363 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | 3,6,6-trimethyl-3-nonan-5-yl-4H-cyclohepta[b]pyridine |
| SMILES | CCCCC(CCCC)C1(C)C=NC2=CC=CC(C)(C)C=C2C1 |
| InChI | InChI=1S/C22H35N/c1-6-8-11-19(12-9-7-2)22(5)16-18-15-21(3,4)14-10-13-20(18)23-17-22/h10,13-15,17,19H,6-9,11-12,16H2,1-5H3 |
| InChIKey | LOGPRGNBZGOEMY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |